C11H8BF2N3S — CID 89081996
CID 89081996 (PubChem CID 89081996) has the molecular formula C11H8BF2N3S and a molecular weight of 263.08 g/mol.
| Compound Name | CID 89081996 |
|---|---|
| PubChem CID | 89081996 |
| Molecular Formula | C11H8BF2N3S |
| Molecular Weight | 263.08 g/mol |
| Exact Mass | 263.05 |
| IUPAC Name | — |
| SMILES | [B]c1cnc(Nc2ccc(F)c(F)c2)nc1SC |
| InChI | InChI=1S/C11H8BF2N3S/c1-18-10-7(12)5-15-11(17-10)16-6-2-3-8(13)9(14)4-6/h2-5H,1H3,(H,15,16,17) |
| InChIKey | YHCQBYDYJWEJJD-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.08 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|