C16H26F6O2 — CID 89088105
5,5-difluoro-2-prop-2-enoxy-1-(3,3,5,5-tetrafluorohexoxy)heptane (PubChem CID 89088105) has the molecular formula C16H26F6O2 and a molecular weight of 364.37 g/mol. Its IUPAC name is 5,5-difluoro-2-prop-2-enoxy-1-(3,3,5,5-tetrafluorohexoxy)heptane.
| Compound Name | 5,5-difluoro-2-prop-2-enoxy-1-(3,3,5,5-tetrafluorohexoxy)heptane |
|---|---|
| PubChem CID | 89088105 |
| Molecular Formula | C16H26F6O2 |
| Molecular Weight | 364.37 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | 5,5-difluoro-2-prop-2-enoxy-1-(3,3,5,5-tetrafluorohexoxy)heptane |
| SMILES | C=CCOC(CCC(F)(F)CC)COCCC(F)(F)CC(C)(F)F |
| InChI | InChI=1S/C16H26F6O2/c1-4-9-24-13(6-7-15(19,20)5-2)11-23-10-8-16(21,22)12-14(3,17)18/h4,13H,1,5-12H2,2-3H3 |
| InChIKey | VBRFQAJLOWBYSJ-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.37 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|