C50H100O6 — CID 123607229
3,5-dimethyl-4-prop-2-enoxyheptane;bis(3-ethyl-3-(prop-2-enoxymethyl)pentane);2-methyl-1-[3-(2-methylbutoxy)-2-prop-2-enoxypropoxy]butane (PubChem CID 123607229) has the molecular formula C50H100O6 and a molecular weight of 797.34 g/mol. Its IUPAC name is 3,5-dimethyl-4-prop-2-enoxyheptane;bis(3-ethyl-3-(prop-2-enoxymethyl)pentane);2-methyl-1-[3-(2-methylbutoxy)-2-prop-2-enoxypropoxy]butane.
| Compound Name | 3,5-dimethyl-4-prop-2-enoxyheptane;bis(3-ethyl-3-(prop-2-enoxymethyl)pentane);2-methyl-1-[3-(2-methylbutoxy)-2-prop-2-enoxypropoxy]butane |
|---|---|
| PubChem CID | 123607229 |
| Molecular Formula | C50H100O6 |
| Molecular Weight | 797.34 g/mol |
| Exact Mass | 796.75 |
| IUPAC Name | 3,5-dimethyl-4-prop-2-enoxyheptane;bis(3-ethyl-3-(prop-2-enoxymethyl)pentane);2-methyl-1-[3-(2-methylbutoxy)-2-prop-2-enoxypropoxy]butane |
| SMILES | C=CCOC(C(C)CC)C(C)CC.C=CCOC(COCC(C)CC)COCC(C)CC.C=CCOCC(CC)(CC)CC.C=CCOCC(CC)(CC)CC |
| InChI | InChI=1S/C16H32O3.C12H24O.2C11H22O/c1-6-9-19-16(12-17-10-14(4)7-2)13-18-11-15(5)8-3;1-6-9-13-12(10(4)7-2)11(5)8-3;2*1-5-9-12-10-11(6-2,7-3)8-4/h6,14-16H,1,7-13H2,2-5H3;6,10-12H,1,7-9H2,2-5H3;2*5H,1,6-10H2,2-4H3 |
| InChIKey | WEZCYHKANOWQGH-UHFFFAOYSA-N |
| XLogP | 14.14 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 797.34 |
| LogP ≤ 5 | 14.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|