C45H75N3O14 — CID 71563363
1-azido-2,3-bis[2,3-bis[2,3-bis(prop-2-enoxy)propoxy]propoxy]propane (PubChem CID 71563363) has the molecular formula C45H75N3O14 and a molecular weight of 882.10 g/mol. Its IUPAC name is 1-azido-2,3-bis[2,3-bis[2,3-bis(prop-2-enoxy)propoxy]propoxy]propane.
| Compound Name | 1-azido-2,3-bis[2,3-bis[2,3-bis(prop-2-enoxy)propoxy]propoxy]propane |
|---|---|
| PubChem CID | 71563363 |
| Molecular Formula | C45H75N3O14 |
| Molecular Weight | 882.10 g/mol |
| Exact Mass | 881.52 |
| IUPAC Name | 1-azido-2,3-bis[2,3-bis[2,3-bis(prop-2-enoxy)propoxy]propoxy]propane |
| SMILES | C=CCOCC(COCC(COCC(CN=[N+]=[N-])OCC(COCC(COCC=C)OCC=C)OCC(COCC=C)OCC=C)OCC(COCC=C)OCC=C)OCC=C |
| InChI | InChI=1S/C45H75N3O14/c1-9-17-49-27-40(56-21-13-5)31-54-34-42(61-36-43(58-23-15-7)29-51-19-11-3)33-53-26-39(25-47-48-46)60-38-45(62-37-44(59-24-16-8)30-52-20-12-4)35-55-32-41(57-22-14-6)28-50-18-10-2/h9-16,39-45H,1-8,17-38H2 |
| InChIKey | KZRQAWCEMVMEQY-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 177.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 51 |
| Heavy Atoms | 62 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 882.10 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|