C24H29FN8O2 — CID 89089328
(7R)-5-N-(3,4-diaminobutoxy)-7-[4-fluoro-2-(6-methoxy-2-pyridinyl)phenyl]-4-methyl-7,8-dihydropyrido[4,3-d]pyrimidine-2,5-diamine (PubChem CID 89089328) has the molecular formula C24H29FN8O2 and a molecular weight of 480.55 g/mol. Its IUPAC name is (7R)-5-N-(3,4-diaminobutoxy)-7-[4-fluoro-2-(6-methoxy-2-pyridinyl)phenyl]-4-methyl-7,8-dihydropyrido[4,3-d]pyrimidine-2,5-diamine.
| Compound Name | (7R)-5-N-(3,4-diaminobutoxy)-7-[4-fluoro-2-(6-methoxy-2-pyridinyl)phenyl]-4-methyl-7,8-dihydropyrido[4,3-d]pyrimidine-2,5-diamine |
|---|---|
| PubChem CID | 89089328 |
| Molecular Formula | C24H29FN8O2 |
| Molecular Weight | 480.55 g/mol |
| Exact Mass | 480.24 |
| IUPAC Name | (7R)-5-N-(3,4-diaminobutoxy)-7-[4-fluoro-2-(6-methoxy-2-pyridinyl)phenyl]-4-methyl-7,8-dihydropyrido[4,3-d]pyrimidine-2,5-diamine |
| SMILES | COc1cccc(-c2cc(F)ccc2[C@H]2Cc3nc(N)nc(C)c3C(NOCCC(N)CN)=N2)n1 |
| InChI | InChI=1S/C24H29FN8O2/c1-13-22-20(32-24(28)29-13)11-19(31-23(22)33-35-9-8-15(27)12-26)16-7-6-14(25)10-17(16)18-4-3-5-21(30-18)34-2/h3-7,10,15,19H,8-9,11-12,26-27H2,1-2H3,(H,31,33)(H2,28,29,32)/t15?,19-/m1/s1 |
| InChIKey | WFAVKZDZBFUUCI-XCWJXAQQSA-N |
| XLogP | 1.82 |
| TPSA | 159.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.55 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|