C25H28FN5O4 — CID 74943170
2-[[[2-amino-7-[4-fluoro-2-(6-methoxy-2-pyridinyl)phenyl]-4-methyl-7,8-dihydro-6H-quinazolin-5-ylidene]amino]oxymethyl]propane-1,3-diol (PubChem CID 74943170) has the molecular formula C25H28FN5O4 and a molecular weight of 481.53 g/mol. Its IUPAC name is 2-[[[2-amino-7-[4-fluoro-2-(6-methoxy-2-pyridinyl)phenyl]-4-methyl-7,8-dihydro-6H-quinazolin-5-ylidene]amino]oxymethyl]propane-1,3-diol.
| Compound Name | 2-[[[2-amino-7-[4-fluoro-2-(6-methoxy-2-pyridinyl)phenyl]-4-methyl-7,8-dihydro-6H-quinazolin-5-ylidene]amino]oxymethyl]propane-1,3-diol |
|---|---|
| PubChem CID | 74943170 |
| Molecular Formula | C25H28FN5O4 |
| Molecular Weight | 481.53 g/mol |
| Exact Mass | 481.21 |
| IUPAC Name | 2-[[[2-amino-7-[4-fluoro-2-(6-methoxy-2-pyridinyl)phenyl]-4-methyl-7,8-dihydro-6H-quinazolin-5-ylidene]amino]oxymethyl]propane-1,3-diol |
| SMILES | COc1cccc(-c2cc(F)ccc2C2CC(=NOCC(CO)CO)c3c(C)nc(N)nc3C2)n1 |
| InChI | InChI=1S/C25H28FN5O4/c1-14-24-21(30-25(27)28-14)8-16(9-22(24)31-35-13-15(11-32)12-33)18-7-6-17(26)10-19(18)20-4-3-5-23(29-20)34-2/h3-7,10,15-16,32-33H,8-9,11-13H2,1-2H3,(H2,27,28,30) |
| InChIKey | ZPJMNEAEYWZTHH-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 135.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.53 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|