C23H24N4O — CID 58269353
(5E)-5-ethoxyimino-4-methyl-7-(2-phenylphenyl)-7,8-dihydro-6H-quinazolin-2-amine (PubChem CID 58269353) has the molecular formula C23H24N4O and a molecular weight of 372.47 g/mol. Its IUPAC name is (5E)-5-ethoxyimino-4-methyl-7-(2-phenylphenyl)-7,8-dihydro-6H-quinazolin-2-amine.
| Compound Name | (5E)-5-ethoxyimino-4-methyl-7-(2-phenylphenyl)-7,8-dihydro-6H-quinazolin-2-amine |
|---|---|
| PubChem CID | 58269353 |
| Molecular Formula | C23H24N4O |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | (5E)-5-ethoxyimino-4-methyl-7-(2-phenylphenyl)-7,8-dihydro-6H-quinazolin-2-amine |
| SMILES | CCO/N=C1\CC(c2ccccc2-c2ccccc2)Cc2nc(N)nc(C)c21 |
| InChI | InChI=1S/C23H24N4O/c1-3-28-27-21-14-17(13-20-22(21)15(2)25-23(24)26-20)19-12-8-7-11-18(19)16-9-5-4-6-10-16/h4-12,17H,3,13-14H2,1-2H3,(H2,24,25,26)/b27-21+ |
| InChIKey | HHERMSKVTREVNY-SZXQPVLSSA-N |
| XLogP | 4.50 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|