C20H19N5O — CID 76750889
N-[2-amino-4-methyl-7-(2-pyridin-3-ylphenyl)-7,8-dihydro-6H-quinazolin-5-ylidene]hydroxylamine (PubChem CID 76750889) has the molecular formula C20H19N5O and a molecular weight of 345.41 g/mol. Its IUPAC name is N-[2-amino-4-methyl-7-(2-pyridin-3-ylphenyl)-7,8-dihydro-6H-quinazolin-5-ylidene]hydroxylamine.
| Compound Name | N-[2-amino-4-methyl-7-(2-pyridin-3-ylphenyl)-7,8-dihydro-6H-quinazolin-5-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 76750889 |
| Molecular Formula | C20H19N5O |
| Molecular Weight | 345.41 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | N-[2-amino-4-methyl-7-(2-pyridin-3-ylphenyl)-7,8-dihydro-6H-quinazolin-5-ylidene]hydroxylamine |
| SMILES | Cc1nc(N)nc2c1C(=NO)CC(c1ccccc1-c1cccnc1)C2 |
| InChI | InChI=1S/C20H19N5O/c1-12-19-17(24-20(21)23-12)9-14(10-18(19)25-26)16-7-3-2-6-15(16)13-5-4-8-22-11-13/h2-8,11,14,26H,9-10H2,1H3,(H2,21,23,24) |
| InChIKey | ALDCUNYXOZZGQC-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 97.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.41 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|