C16H18N4O — CID 25167617
(NE)-N-[2-amino-4-methyl-7-(4-methylphenyl)-7,8-dihydro-6H-quinazolin-5-ylidene]hydroxylamine (PubChem CID 25167617) has the molecular formula C16H18N4O and a molecular weight of 282.35 g/mol. Its IUPAC name is (NE)-N-[2-amino-4-methyl-7-(4-methylphenyl)-7,8-dihydro-6H-quinazolin-5-ylidene]hydroxylamine.
| Compound Name | (NE)-N-[2-amino-4-methyl-7-(4-methylphenyl)-7,8-dihydro-6H-quinazolin-5-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 25167617 |
| Molecular Formula | C16H18N4O |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | (NE)-N-[2-amino-4-methyl-7-(4-methylphenyl)-7,8-dihydro-6H-quinazolin-5-ylidene]hydroxylamine |
| SMILES | Cc1ccc(C2C/C(=N\O)c3c(C)nc(N)nc3C2)cc1 |
| InChI | InChI=1S/C16H18N4O/c1-9-3-5-11(6-4-9)12-7-13-15(14(8-12)20-21)10(2)18-16(17)19-13/h3-6,12,21H,7-8H2,1-2H3,(H2,17,18,19)/b20-14+ |
| InChIKey | MNUVOMRRRXBAAX-XSFVSMFZSA-N |
| XLogP | 2.58 |
| TPSA | 84.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|