C15H15FN4O — CID 87291152
(NZ)-N-[2-amino-7-(2-fluorophenyl)-4-methyl-7,8-dihydro-6H-quinazolin-5-ylidene]hydroxylamine (PubChem CID 87291152) has the molecular formula C15H15FN4O and a molecular weight of 286.31 g/mol. Its IUPAC name is (NZ)-N-[2-amino-7-(2-fluorophenyl)-4-methyl-7,8-dihydro-6H-quinazolin-5-ylidene]hydroxylamine.
| Compound Name | (NZ)-N-[2-amino-7-(2-fluorophenyl)-4-methyl-7,8-dihydro-6H-quinazolin-5-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 87291152 |
| Molecular Formula | C15H15FN4O |
| Molecular Weight | 286.31 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | (NZ)-N-[2-amino-7-(2-fluorophenyl)-4-methyl-7,8-dihydro-6H-quinazolin-5-ylidene]hydroxylamine |
| SMILES | Cc1nc(N)nc2c1/C(=N\O)CC(c1ccccc1F)C2 |
| InChI | InChI=1S/C15H15FN4O/c1-8-14-12(19-15(17)18-8)6-9(7-13(14)20-21)10-4-2-3-5-11(10)16/h2-5,9,21H,6-7H2,1H3,(H2,17,18,19)/b20-13- |
| InChIKey | ONVOOYCSVAYMEE-MOSHPQCFSA-N |
| XLogP | 2.41 |
| TPSA | 84.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.31 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|