C17H19ClFN5 — CID 70162401
2-[[7-(2-fluorophenyl)-4-methyl-7,8-dihydro-6H-quinolin-5-ylidene]amino]guanidine;hydrochloride (PubChem CID 70162401) has the molecular formula C17H19ClFN5 and a molecular weight of 347.83 g/mol. Its IUPAC name is 2-[[7-(2-fluorophenyl)-4-methyl-7,8-dihydro-6H-quinolin-5-ylidene]amino]guanidine;hydrochloride.
| Compound Name | 2-[[7-(2-fluorophenyl)-4-methyl-7,8-dihydro-6H-quinolin-5-ylidene]amino]guanidine;hydrochloride |
|---|---|
| PubChem CID | 70162401 |
| Molecular Formula | C17H19ClFN5 |
| Molecular Weight | 347.83 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | 2-[[7-(2-fluorophenyl)-4-methyl-7,8-dihydro-6H-quinolin-5-ylidene]amino]guanidine;hydrochloride |
| SMILES | Cc1ccnc2c1C(=NN=C(N)N)CC(c1ccccc1F)C2.Cl |
| InChI | InChI=1S/C17H18FN5.ClH/c1-10-6-7-21-14-8-11(12-4-2-3-5-13(12)18)9-15(16(10)14)22-23-17(19)20;/h2-7,11H,8-9H2,1H3,(H4,19,20,23);1H |
| InChIKey | PCNFLPBUVKYLOS-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 89.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.83 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|