C16H18ClN5S — CID 57184638
2-[[7-(3-chloro-5-methylthiophen-2-yl)-4-methyl-7,8-dihydro-6H-quinolin-5-ylidene]amino]guanidine (PubChem CID 57184638) has the molecular formula C16H18ClN5S and a molecular weight of 347.88 g/mol. Its IUPAC name is 2-[[7-(3-chloro-5-methylthiophen-2-yl)-4-methyl-7,8-dihydro-6H-quinolin-5-ylidene]amino]guanidine.
| Compound Name | 2-[[7-(3-chloro-5-methylthiophen-2-yl)-4-methyl-7,8-dihydro-6H-quinolin-5-ylidene]amino]guanidine |
|---|---|
| PubChem CID | 57184638 |
| Molecular Formula | C16H18ClN5S |
| Molecular Weight | 347.88 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | 2-[[7-(3-chloro-5-methylthiophen-2-yl)-4-methyl-7,8-dihydro-6H-quinolin-5-ylidene]amino]guanidine |
| SMILES | Cc1cc(Cl)c(C2CC(=NN=C(N)N)c3c(C)ccnc3C2)s1 |
| InChI | InChI=1S/C16H18ClN5S/c1-8-3-4-20-12-6-10(15-11(17)5-9(2)23-15)7-13(14(8)12)21-22-16(18)19/h3-5,10H,6-7H2,1-2H3,(H4,18,19,22) |
| InChIKey | DZWSYZAAAFOIHB-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 89.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.88 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|