C16H19Cl2N5S — CID 18317752
2-[(Z)-[7-(5-chloro-3-methylthiophen-2-yl)-4-methyl-7,8-dihydro-6H-quinolin-5-ylidene]amino]guanidine;hydrochloride (PubChem CID 18317752) has the molecular formula C16H19Cl2N5S and a molecular weight of 384.34 g/mol. Its IUPAC name is 2-[(Z)-[7-(5-chloro-3-methylthiophen-2-yl)-4-methyl-7,8-dihydro-6H-quinolin-5-ylidene]amino]guanidine;hydrochloride.
| Compound Name | 2-[(Z)-[7-(5-chloro-3-methylthiophen-2-yl)-4-methyl-7,8-dihydro-6H-quinolin-5-ylidene]amino]guanidine;hydrochloride |
|---|---|
| PubChem CID | 18317752 |
| Molecular Formula | C16H19Cl2N5S |
| Molecular Weight | 384.34 g/mol |
| Exact Mass | 383.07 |
| IUPAC Name | 2-[(Z)-[7-(5-chloro-3-methylthiophen-2-yl)-4-methyl-7,8-dihydro-6H-quinolin-5-ylidene]amino]guanidine;hydrochloride |
| SMILES | Cc1cc(Cl)sc1C1C/C(=N/N=C(N)N)c2c(C)ccnc2C1.Cl |
| InChI | InChI=1S/C16H18ClN5S.ClH/c1-8-3-4-20-11-6-10(15-9(2)5-13(17)23-15)7-12(14(8)11)21-22-16(18)19;/h3-5,10H,6-7H2,1-2H3,(H4,18,19,22);1H/b21-12-; |
| InChIKey | RGOIQOFRKYCODO-SDKPGJOKSA-N |
| XLogP | 3.54 |
| TPSA | 89.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.34 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|