C14H17ClN6S — CID 18317491
2-[(Z)-[4-methyl-7-(1,3-thiazol-2-yl)-7,8-dihydro-6H-quinolin-5-ylidene]amino]guanidine;hydrochloride (PubChem CID 18317491) has the molecular formula C14H17ClN6S and a molecular weight of 336.85 g/mol. Its IUPAC name is 2-[(Z)-[4-methyl-7-(1,3-thiazol-2-yl)-7,8-dihydro-6H-quinolin-5-ylidene]amino]guanidine;hydrochloride.
| Compound Name | 2-[(Z)-[4-methyl-7-(1,3-thiazol-2-yl)-7,8-dihydro-6H-quinolin-5-ylidene]amino]guanidine;hydrochloride |
|---|---|
| PubChem CID | 18317491 |
| Molecular Formula | C14H17ClN6S |
| Molecular Weight | 336.85 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | 2-[(Z)-[4-methyl-7-(1,3-thiazol-2-yl)-7,8-dihydro-6H-quinolin-5-ylidene]amino]guanidine;hydrochloride |
| SMILES | Cc1ccnc2c1/C(=N\N=C(N)N)CC(c1nccs1)C2.Cl |
| InChI | InChI=1S/C14H16N6S.ClH/c1-8-2-3-17-10-6-9(13-18-4-5-21-13)7-11(12(8)10)19-20-14(15)16;/h2-5,9H,6-7H2,1H3,(H4,15,16,20);1H/b19-11-; |
| InChIKey | RKRNHYAKSLPCRA-XHFAFUTOSA-N |
| XLogP | 1.98 |
| TPSA | 102.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.85 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|