C14H17ClN4OS — CID 70161161
2-[(3-methyl-6-thiophen-2-yl-6,7-dihydro-5H-1-benzofuran-4-ylidene)amino]guanidine;hydrochloride (PubChem CID 70161161) has the molecular formula C14H17ClN4OS and a molecular weight of 324.84 g/mol. Its IUPAC name is 2-[(3-methyl-6-thiophen-2-yl-6,7-dihydro-5H-1-benzofuran-4-ylidene)amino]guanidine;hydrochloride.
| Compound Name | 2-[(3-methyl-6-thiophen-2-yl-6,7-dihydro-5H-1-benzofuran-4-ylidene)amino]guanidine;hydrochloride |
|---|---|
| PubChem CID | 70161161 |
| Molecular Formula | C14H17ClN4OS |
| Molecular Weight | 324.84 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | 2-[(3-methyl-6-thiophen-2-yl-6,7-dihydro-5H-1-benzofuran-4-ylidene)amino]guanidine;hydrochloride |
| SMILES | Cc1coc2c1C(=NN=C(N)N)CC(c1cccs1)C2.Cl |
| InChI | InChI=1S/C14H16N4OS.ClH/c1-8-7-19-11-6-9(12-3-2-4-20-12)5-10(13(8)11)17-18-14(15)16;/h2-4,7,9H,5-6H2,1H3,(H4,15,16,18);1H |
| InChIKey | ROZOWEJLIHDRFJ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.84 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|