C18H20ClN5 — CID 57149116
2-[[7-(2-chloro-5-methylphenyl)-4-methyl-7,8-dihydro-6H-quinolin-5-ylidene]amino]guanidine (PubChem CID 57149116) has the molecular formula C18H20ClN5 and a molecular weight of 341.85 g/mol. Its IUPAC name is 2-[[7-(2-chloro-5-methylphenyl)-4-methyl-7,8-dihydro-6H-quinolin-5-ylidene]amino]guanidine.
| Compound Name | 2-[[7-(2-chloro-5-methylphenyl)-4-methyl-7,8-dihydro-6H-quinolin-5-ylidene]amino]guanidine |
|---|---|
| PubChem CID | 57149116 |
| Molecular Formula | C18H20ClN5 |
| Molecular Weight | 341.85 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 2-[[7-(2-chloro-5-methylphenyl)-4-methyl-7,8-dihydro-6H-quinolin-5-ylidene]amino]guanidine |
| SMILES | Cc1ccc(Cl)c(C2CC(=NN=C(N)N)c3c(C)ccnc3C2)c1 |
| InChI | InChI=1S/C18H20ClN5/c1-10-3-4-14(19)13(7-10)12-8-15-17(11(2)5-6-22-15)16(9-12)23-24-18(20)21/h3-7,12H,8-9H2,1-2H3,(H4,20,21,24) |
| InChIKey | VVIVRHZRBHMPSX-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 89.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.85 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|