C17H17Cl2N5 — CID 57059464
2-[[7-(2,3-dichlorophenyl)-4-methyl-7,8-dihydro-6H-quinolin-5-ylidene]amino]guanidine (PubChem CID 57059464) has the molecular formula C17H17Cl2N5 and a molecular weight of 362.26 g/mol. Its IUPAC name is 2-[[7-(2,3-dichlorophenyl)-4-methyl-7,8-dihydro-6H-quinolin-5-ylidene]amino]guanidine.
| Compound Name | 2-[[7-(2,3-dichlorophenyl)-4-methyl-7,8-dihydro-6H-quinolin-5-ylidene]amino]guanidine |
|---|---|
| PubChem CID | 57059464 |
| Molecular Formula | C17H17Cl2N5 |
| Molecular Weight | 362.26 g/mol |
| Exact Mass | 361.09 |
| IUPAC Name | 2-[[7-(2,3-dichlorophenyl)-4-methyl-7,8-dihydro-6H-quinolin-5-ylidene]amino]guanidine |
| SMILES | Cc1ccnc2c1C(=NN=C(N)N)CC(c1cccc(Cl)c1Cl)C2 |
| InChI | InChI=1S/C17H17Cl2N5/c1-9-5-6-22-13-7-10(11-3-2-4-12(18)16(11)19)8-14(15(9)13)23-24-17(20)21/h2-6,10H,7-8H2,1H3,(H4,20,21,24) |
| InChIKey | CLYURFQWTBFTGL-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 89.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.26 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|