C15H15Br2N5S — CID 57122097
2-[[7-(2,5-dibromothiophen-3-yl)-4-methyl-7,8-dihydro-6H-quinolin-5-ylidene]amino]guanidine (PubChem CID 57122097) has the molecular formula C15H15Br2N5S and a molecular weight of 457.20 g/mol. Its IUPAC name is 2-[[7-(2,5-dibromothiophen-3-yl)-4-methyl-7,8-dihydro-6H-quinolin-5-ylidene]amino]guanidine.
| Compound Name | 2-[[7-(2,5-dibromothiophen-3-yl)-4-methyl-7,8-dihydro-6H-quinolin-5-ylidene]amino]guanidine |
|---|---|
| PubChem CID | 57122097 |
| Molecular Formula | C15H15Br2N5S |
| Molecular Weight | 457.20 g/mol |
| Exact Mass | 454.94 |
| IUPAC Name | 2-[[7-(2,5-dibromothiophen-3-yl)-4-methyl-7,8-dihydro-6H-quinolin-5-ylidene]amino]guanidine |
| SMILES | Cc1ccnc2c1C(=NN=C(N)N)CC(c1cc(Br)sc1Br)C2 |
| InChI | InChI=1S/C15H15Br2N5S/c1-7-2-3-20-10-4-8(9-6-12(16)23-14(9)17)5-11(13(7)10)21-22-15(18)19/h2-3,6,8H,4-5H2,1H3,(H4,18,19,22) |
| InChIKey | GPENXDWOZYGUQI-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 89.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.20 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|