C13H15Br2ClN6OS — CID 158342860
2-[[6-(2,5-dibromothiophen-3-yl)-3-methyl-2,5,6,7-tetrahydroindazol-4-ylidene]amino]-1-hydroxyguanidine;hydrochloride (PubChem CID 158342860) has the molecular formula C13H15Br2ClN6OS and a molecular weight of 498.63 g/mol. Its IUPAC name is 2-[[6-(2,5-dibromothiophen-3-yl)-3-methyl-2,5,6,7-tetrahydroindazol-4-ylidene]amino]-1-hydroxyguanidine;hydrochloride.
| Compound Name | 2-[[6-(2,5-dibromothiophen-3-yl)-3-methyl-2,5,6,7-tetrahydroindazol-4-ylidene]amino]-1-hydroxyguanidine;hydrochloride |
|---|---|
| PubChem CID | 158342860 |
| Molecular Formula | C13H15Br2ClN6OS |
| Molecular Weight | 498.63 g/mol |
| Exact Mass | 495.91 |
| IUPAC Name | 2-[[6-(2,5-dibromothiophen-3-yl)-3-methyl-2,5,6,7-tetrahydroindazol-4-ylidene]amino]-1-hydroxyguanidine;hydrochloride |
| SMILES | Cc1[nH]nc2c1C(=NN=C(N)NO)CC(c1cc(Br)sc1Br)C2.Cl |
| InChI | InChI=1S/C13H14Br2N6OS.ClH/c1-5-11-8(18-17-5)2-6(7-4-10(14)23-12(7)15)3-9(11)19-20-13(16)21-22;/h4,6,22H,2-3H2,1H3,(H,17,18)(H3,16,20,21);1H |
| InChIKey | GRJGCGBARKUTHC-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 111.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.63 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|