C14H15N3O — CID 135923483
(NZ)-N-(3-methyl-6-phenyl-2,5,6,7-tetrahydroindazol-4-ylidene)hydroxylamine (PubChem CID 135923483) has the molecular formula C14H15N3O and a molecular weight of 241.29 g/mol. Its IUPAC name is (NZ)-N-(3-methyl-6-phenyl-2,5,6,7-tetrahydroindazol-4-ylidene)hydroxylamine.
| Compound Name | (NZ)-N-(3-methyl-6-phenyl-2,5,6,7-tetrahydroindazol-4-ylidene)hydroxylamine |
|---|---|
| PubChem CID | 135923483 |
| Molecular Formula | C14H15N3O |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | (NZ)-N-(3-methyl-6-phenyl-2,5,6,7-tetrahydroindazol-4-ylidene)hydroxylamine |
| SMILES | Cc1[nH]nc2c1/C(=N\O)CC(c1ccccc1)C2 |
| InChI | InChI=1S/C14H15N3O/c1-9-14-12(16-15-9)7-11(8-13(14)17-18)10-5-3-2-4-6-10/h2-6,11,18H,7-8H2,1H3,(H,15,16)/b17-13- |
| InChIKey | ITLUALADFBZOPF-LGMDPLHJSA-N |
| XLogP | 2.63 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|