C16H18N2O2 — CID 6339675
(NE)-N-[(6S)-6-phenyl-3-propyl-6,7-dihydro-5H-1,2-benzoxazol-4-ylidene]hydroxylamine (PubChem CID 6339675) has the molecular formula C16H18N2O2 and a molecular weight of 270.33 g/mol. Its IUPAC name is (NE)-N-[(6S)-6-phenyl-3-propyl-6,7-dihydro-5H-1,2-benzoxazol-4-ylidene]hydroxylamine.
| Compound Name | (NE)-N-[(6S)-6-phenyl-3-propyl-6,7-dihydro-5H-1,2-benzoxazol-4-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 6339675 |
| Molecular Formula | C16H18N2O2 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | (NE)-N-[(6S)-6-phenyl-3-propyl-6,7-dihydro-5H-1,2-benzoxazol-4-ylidene]hydroxylamine |
| SMILES | CCCc1noc2c1/C(=N/O)C[C@H](c1ccccc1)C2 |
| InChI | InChI=1S/C16H18N2O2/c1-2-6-13-16-14(17-19)9-12(10-15(16)20-18-13)11-7-4-3-5-8-11/h3-5,7-8,12,19H,2,6,9-10H2,1H3/b17-14+/t12-/m0/s1 |
| InChIKey | AXJATIZSPNEBAD-KNEMVRMJSA-N |
| XLogP | 3.54 |
| TPSA | 58.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|