C16H19N3O — CID 135850798
(NE)-N-[(6S)-6-phenyl-3-propyl-1,5,6,7-tetrahydroindazol-4-ylidene]hydroxylamine (PubChem CID 135850798) has the molecular formula C16H19N3O and a molecular weight of 269.35 g/mol. Its IUPAC name is (NE)-N-[(6S)-6-phenyl-3-propyl-1,5,6,7-tetrahydroindazol-4-ylidene]hydroxylamine.
| Compound Name | (NE)-N-[(6S)-6-phenyl-3-propyl-1,5,6,7-tetrahydroindazol-4-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 135850798 |
| Molecular Formula | C16H19N3O |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.15 |
| IUPAC Name | (NE)-N-[(6S)-6-phenyl-3-propyl-1,5,6,7-tetrahydroindazol-4-ylidene]hydroxylamine |
| SMILES | CCCc1n[nH]c2c1/C(=N/O)C[C@@H](c1ccccc1)C2 |
| InChI | InChI=1S/C16H19N3O/c1-2-6-13-16-14(18-17-13)9-12(10-15(16)19-20)11-7-4-3-5-8-11/h3-5,7-8,12,20H,2,6,9-10H2,1H3,(H,17,18)/b19-15+/t12-/m0/s1 |
| InChIKey | JMTJKBDDZABGFJ-OGAOFSLMSA-N |
| XLogP | 3.27 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|