C17H17Cl2N5O — CID 57142491
2-[[7-(2,3-dichlorophenyl)-4-methyl-7,8-dihydro-6H-quinolin-5-ylidene]amino]-1-hydroxyguanidine (PubChem CID 57142491) has the molecular formula C17H17Cl2N5O and a molecular weight of 378.26 g/mol. Its IUPAC name is 2-[[7-(2,3-dichlorophenyl)-4-methyl-7,8-dihydro-6H-quinolin-5-ylidene]amino]-1-hydroxyguanidine.
| Compound Name | 2-[[7-(2,3-dichlorophenyl)-4-methyl-7,8-dihydro-6H-quinolin-5-ylidene]amino]-1-hydroxyguanidine |
|---|---|
| PubChem CID | 57142491 |
| Molecular Formula | C17H17Cl2N5O |
| Molecular Weight | 378.26 g/mol |
| Exact Mass | 377.08 |
| IUPAC Name | 2-[[7-(2,3-dichlorophenyl)-4-methyl-7,8-dihydro-6H-quinolin-5-ylidene]amino]-1-hydroxyguanidine |
| SMILES | Cc1ccnc2c1C(=NN=C(N)NO)CC(c1cccc(Cl)c1Cl)C2 |
| InChI | InChI=1S/C17H17Cl2N5O/c1-9-5-6-21-13-7-10(11-3-2-4-12(18)16(11)19)8-14(15(9)13)22-23-17(20)24-25/h2-6,10,25H,7-8H2,1H3,(H3,20,23,24) |
| InChIKey | MDQOVYUSIHETIM-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 95.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.26 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|