C15H17Cl2N5O — CID 18317798
2-[(Z)-[6-(2-chlorophenyl)-3-methyl-6,7-dihydro-5H-2,1-benzoxazol-4-ylidene]amino]guanidine;hydrochloride (PubChem CID 18317798) has the molecular formula C15H17Cl2N5O and a molecular weight of 354.24 g/mol. Its IUPAC name is 2-[(Z)-[6-(2-chlorophenyl)-3-methyl-6,7-dihydro-5H-2,1-benzoxazol-4-ylidene]amino]guanidine;hydrochloride.
| Compound Name | 2-[(Z)-[6-(2-chlorophenyl)-3-methyl-6,7-dihydro-5H-2,1-benzoxazol-4-ylidene]amino]guanidine;hydrochloride |
|---|---|
| PubChem CID | 18317798 |
| Molecular Formula | C15H17Cl2N5O |
| Molecular Weight | 354.24 g/mol |
| Exact Mass | 353.08 |
| IUPAC Name | 2-[(Z)-[6-(2-chlorophenyl)-3-methyl-6,7-dihydro-5H-2,1-benzoxazol-4-ylidene]amino]guanidine;hydrochloride |
| SMILES | Cc1onc2c1/C(=N\N=C(N)N)CC(c1ccccc1Cl)C2.Cl |
| InChI | InChI=1S/C15H16ClN5O.ClH/c1-8-14-12(19-20-15(17)18)6-9(7-13(14)21-22-8)10-4-2-3-5-11(10)16;/h2-5,9H,6-7H2,1H3,(H4,17,18,20);1H/b19-12-; |
| InChIKey | GCEVCJIODVJXHW-JHMJKTBASA-N |
| XLogP | 2.77 |
| TPSA | 102.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.24 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|