C17H22ClN5 — CID 135581637
2-[(E)-[3-methyl-6-(2-methylphenyl)-1,5,6,7-tetrahydroindol-4-ylidene]amino]guanidine;hydrochloride (PubChem CID 135581637) has the molecular formula C17H22ClN5 and a molecular weight of 331.85 g/mol. Its IUPAC name is 2-[(E)-[3-methyl-6-(2-methylphenyl)-1,5,6,7-tetrahydroindol-4-ylidene]amino]guanidine;hydrochloride.
| Compound Name | 2-[(E)-[3-methyl-6-(2-methylphenyl)-1,5,6,7-tetrahydroindol-4-ylidene]amino]guanidine;hydrochloride |
|---|---|
| PubChem CID | 135581637 |
| Molecular Formula | C17H22ClN5 |
| Molecular Weight | 331.85 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | 2-[(E)-[3-methyl-6-(2-methylphenyl)-1,5,6,7-tetrahydroindol-4-ylidene]amino]guanidine;hydrochloride |
| SMILES | Cc1ccccc1C1C/C(=N\N=C(N)N)c2c(C)c[nH]c2C1.Cl |
| InChI | InChI=1S/C17H21N5.ClH/c1-10-5-3-4-6-13(10)12-7-14-16(11(2)9-20-14)15(8-12)21-22-17(18)19;/h3-6,9,12,20H,7-8H2,1-2H3,(H4,18,19,22);1H/b21-15+; |
| InChIKey | KGHNMNUGWGCDFP-NEMIEIFKSA-N |
| XLogP | 2.76 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.85 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|