C17H21N5 — CID 57093884
2-[(1,3-dimethyl-6-phenyl-6,7-dihydro-5H-indol-4-ylidene)amino]guanidine (PubChem CID 57093884) has the molecular formula C17H21N5 and a molecular weight of 295.39 g/mol. Its IUPAC name is 2-[(1,3-dimethyl-6-phenyl-6,7-dihydro-5H-indol-4-ylidene)amino]guanidine.
| Compound Name | 2-[(1,3-dimethyl-6-phenyl-6,7-dihydro-5H-indol-4-ylidene)amino]guanidine |
|---|---|
| PubChem CID | 57093884 |
| Molecular Formula | C17H21N5 |
| Molecular Weight | 295.39 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | 2-[(1,3-dimethyl-6-phenyl-6,7-dihydro-5H-indol-4-ylidene)amino]guanidine |
| SMILES | Cc1cn(C)c2c1C(=NN=C(N)N)CC(c1ccccc1)C2 |
| InChI | InChI=1S/C17H21N5/c1-11-10-22(2)15-9-13(12-6-4-3-5-7-12)8-14(16(11)15)20-21-17(18)19/h3-7,10,13H,8-9H2,1-2H3,(H4,18,19,21) |
| InChIKey | UIBJNMNANQJYEI-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 81.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.39 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|