C19H18BrN5 — CID 135847963
2-[(E)-(6-bromo-2-phenyl-1,2,3,9-tetrahydrocarbazol-4-ylidene)amino]guanidine (PubChem CID 135847963) has the molecular formula C19H18BrN5 and a molecular weight of 396.29 g/mol. Its IUPAC name is 2-[(E)-(6-bromo-2-phenyl-1,2,3,9-tetrahydrocarbazol-4-ylidene)amino]guanidine.
| Compound Name | 2-[(E)-(6-bromo-2-phenyl-1,2,3,9-tetrahydrocarbazol-4-ylidene)amino]guanidine |
|---|---|
| PubChem CID | 135847963 |
| Molecular Formula | C19H18BrN5 |
| Molecular Weight | 396.29 g/mol |
| Exact Mass | 395.07 |
| IUPAC Name | 2-[(E)-(6-bromo-2-phenyl-1,2,3,9-tetrahydrocarbazol-4-ylidene)amino]guanidine |
| SMILES | NC(N)=N/N=C1\CC(c2ccccc2)Cc2[nH]c3ccc(Br)cc3c21 |
| InChI | InChI=1S/C19H18BrN5/c20-13-6-7-15-14(10-13)18-16(23-15)8-12(11-4-2-1-3-5-11)9-17(18)24-25-19(21)22/h1-7,10,12,23H,8-9H2,(H4,21,22,25)/b24-17+ |
| InChIKey | NCSSFMOFLABCHX-JJIBRWJFSA-N |
| XLogP | 3.64 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.29 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|