C17H20ClN5O2S — CID 18317316
2-[(E)-[6-(2-chlorophenyl)-3-methyl-1-methylsulfonyl-6,7-dihydro-5H-indol-4-ylidene]amino]guanidine (PubChem CID 18317316) has the molecular formula C17H20ClN5O2S and a molecular weight of 393.90 g/mol. Its IUPAC name is 2-[(E)-[6-(2-chlorophenyl)-3-methyl-1-methylsulfonyl-6,7-dihydro-5H-indol-4-ylidene]amino]guanidine.
| Compound Name | 2-[(E)-[6-(2-chlorophenyl)-3-methyl-1-methylsulfonyl-6,7-dihydro-5H-indol-4-ylidene]amino]guanidine |
|---|---|
| PubChem CID | 18317316 |
| Molecular Formula | C17H20ClN5O2S |
| Molecular Weight | 393.90 g/mol |
| Exact Mass | 393.10 |
| IUPAC Name | 2-[(E)-[6-(2-chlorophenyl)-3-methyl-1-methylsulfonyl-6,7-dihydro-5H-indol-4-ylidene]amino]guanidine |
| SMILES | Cc1cn(S(C)(=O)=O)c2c1/C(=N/N=C(N)N)CC(c1ccccc1Cl)C2 |
| InChI | InChI=1S/C17H20ClN5O2S/c1-10-9-23(26(2,24)25)15-8-11(12-5-3-4-6-13(12)18)7-14(16(10)15)21-22-17(19)20/h3-6,9,11H,7-8H2,1-2H3,(H4,19,20,22)/b21-14+ |
| InChIKey | DSVWNHHGIJKPET-KGENOOAVSA-N |
| XLogP | 1.97 |
| TPSA | 115.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.90 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|