C25H29FN6O — CID 87549235
5-[3-(dimethylamino)propoxyimino]-7-(3-fluoro-2-pyridin-3-ylphenyl)-4-methyl-7,8-dihydro-6H-quinazolin-2-amine (PubChem CID 87549235) has the molecular formula C25H29FN6O and a molecular weight of 448.55 g/mol. Its IUPAC name is 5-[3-(dimethylamino)propoxyimino]-7-(3-fluoro-2-pyridin-3-ylphenyl)-4-methyl-7,8-dihydro-6H-quinazolin-2-amine.
| Compound Name | 5-[3-(dimethylamino)propoxyimino]-7-(3-fluoro-2-pyridin-3-ylphenyl)-4-methyl-7,8-dihydro-6H-quinazolin-2-amine |
|---|---|
| PubChem CID | 87549235 |
| Molecular Formula | C25H29FN6O |
| Molecular Weight | 448.55 g/mol |
| Exact Mass | 448.24 |
| IUPAC Name | 5-[3-(dimethylamino)propoxyimino]-7-(3-fluoro-2-pyridin-3-ylphenyl)-4-methyl-7,8-dihydro-6H-quinazolin-2-amine |
| SMILES | Cc1nc(N)nc2c1C(=NOCCCN(C)C)CC(c1cccc(F)c1-c1cccnc1)C2 |
| InChI | InChI=1S/C25H29FN6O/c1-16-23-21(30-25(27)29-16)13-18(14-22(23)31-33-12-6-11-32(2)3)19-8-4-9-20(26)24(19)17-7-5-10-28-15-17/h4-5,7-10,15,18H,6,11-14H2,1-3H3,(H2,27,29,30) |
| InChIKey | OPXLJJWPLVAGQP-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 89.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.55 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|