C26H29FN6O — CID 71558560
(5E)-7-(4-fluoro-2-pyridin-3-ylphenyl)-4-methyl-5-[2-[(2R)-pyrrolidin-2-yl]ethoxyimino]-7,8-dihydro-6H-quinazolin-2-amine (PubChem CID 71558560) has the molecular formula C26H29FN6O and a molecular weight of 460.56 g/mol. Its IUPAC name is (5E)-7-(4-fluoro-2-pyridin-3-ylphenyl)-4-methyl-5-[2-[(2R)-pyrrolidin-2-yl]ethoxyimino]-7,8-dihydro-6H-quinazolin-2-amine.
| Compound Name | (5E)-7-(4-fluoro-2-pyridin-3-ylphenyl)-4-methyl-5-[2-[(2R)-pyrrolidin-2-yl]ethoxyimino]-7,8-dihydro-6H-quinazolin-2-amine |
|---|---|
| PubChem CID | 71558560 |
| Molecular Formula | C26H29FN6O |
| Molecular Weight | 460.56 g/mol |
| Exact Mass | 460.24 |
| IUPAC Name | (5E)-7-(4-fluoro-2-pyridin-3-ylphenyl)-4-methyl-5-[2-[(2R)-pyrrolidin-2-yl]ethoxyimino]-7,8-dihydro-6H-quinazolin-2-amine |
| SMILES | Cc1nc(N)nc2c1/C(=N/OCC[C@H]1CCCN1)CC(c1ccc(F)cc1-c1cccnc1)C2 |
| InChI | InChI=1S/C26H29FN6O/c1-16-25-23(32-26(28)31-16)12-18(13-24(25)33-34-11-8-20-5-3-10-30-20)21-7-6-19(27)14-22(21)17-4-2-9-29-15-17/h2,4,6-7,9,14-15,18,20,30H,3,5,8,10-13H2,1H3,(H2,28,31,32)/b33-24+/t18?,20-/m1/s1 |
| InChIKey | YLAVQXJDXWQOOL-ZKMJFNHASA-N |
| XLogP | 4.16 |
| TPSA | 98.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.56 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|