C25H27FN6O — CID 71558410
(5E)-7-(4-fluoro-2-pyridin-3-ylphenyl)-4-methyl-5-[[(3R)-pyrrolidin-3-yl]methoxyimino]-7,8-dihydro-6H-quinazolin-2-amine (PubChem CID 71558410) has the molecular formula C25H27FN6O and a molecular weight of 446.53 g/mol. Its IUPAC name is (5E)-7-(4-fluoro-2-pyridin-3-ylphenyl)-4-methyl-5-[[(3R)-pyrrolidin-3-yl]methoxyimino]-7,8-dihydro-6H-quinazolin-2-amine.
| Compound Name | (5E)-7-(4-fluoro-2-pyridin-3-ylphenyl)-4-methyl-5-[[(3R)-pyrrolidin-3-yl]methoxyimino]-7,8-dihydro-6H-quinazolin-2-amine |
|---|---|
| PubChem CID | 71558410 |
| Molecular Formula | C25H27FN6O |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.22 |
| IUPAC Name | (5E)-7-(4-fluoro-2-pyridin-3-ylphenyl)-4-methyl-5-[[(3R)-pyrrolidin-3-yl]methoxyimino]-7,8-dihydro-6H-quinazolin-2-amine |
| SMILES | Cc1nc(N)nc2c1/C(=N/OC[C@@H]1CCNC1)CC(c1ccc(F)cc1-c1cccnc1)C2 |
| InChI | InChI=1S/C25H27FN6O/c1-15-24-22(31-25(27)30-15)9-18(10-23(24)32-33-14-16-6-8-29-12-16)20-5-4-19(26)11-21(20)17-3-2-7-28-13-17/h2-5,7,11,13,16,18,29H,6,8-10,12,14H2,1H3,(H2,27,30,31)/b32-23+/t16-,18?/m1/s1 |
| InChIKey | CIHTYPDJSWZTTO-TYUPMZHWSA-N |
| XLogP | 3.63 |
| TPSA | 98.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|