C25H27FN6O — CID 78111250
7-(4-fluoro-2-pyridin-3-ylphenyl)-4-methyl-5-piperidin-4-yloxyimino-7,8-dihydro-6H-quinazolin-2-amine (PubChem CID 78111250) has the molecular formula C25H27FN6O and a molecular weight of 446.53 g/mol. Its IUPAC name is 7-(4-fluoro-2-pyridin-3-ylphenyl)-4-methyl-5-piperidin-4-yloxyimino-7,8-dihydro-6H-quinazolin-2-amine.
| Compound Name | 7-(4-fluoro-2-pyridin-3-ylphenyl)-4-methyl-5-piperidin-4-yloxyimino-7,8-dihydro-6H-quinazolin-2-amine |
|---|---|
| PubChem CID | 78111250 |
| Molecular Formula | C25H27FN6O |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.22 |
| IUPAC Name | 7-(4-fluoro-2-pyridin-3-ylphenyl)-4-methyl-5-piperidin-4-yloxyimino-7,8-dihydro-6H-quinazolin-2-amine |
| SMILES | Cc1nc(N)nc2c1C(=NOC1CCNCC1)CC(c1ccc(F)cc1-c1cccnc1)C2 |
| InChI | InChI=1S/C25H27FN6O/c1-15-24-22(31-25(27)30-15)11-17(12-23(24)32-33-19-6-9-28-10-7-19)20-5-4-18(26)13-21(20)16-3-2-8-29-14-16/h2-5,8,13-14,17,19,28H,6-7,9-12H2,1H3,(H2,27,30,31) |
| InChIKey | OTAFMENDQSWXDA-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 98.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|