C16H17FN4O — CID 25167747
(5E)-7-(2-fluorophenyl)-5-methoxyimino-4-methyl-7,8-dihydro-6H-quinazolin-2-amine (PubChem CID 25167747) has the molecular formula C16H17FN4O and a molecular weight of 300.34 g/mol. Its IUPAC name is (5E)-7-(2-fluorophenyl)-5-methoxyimino-4-methyl-7,8-dihydro-6H-quinazolin-2-amine.
| Compound Name | (5E)-7-(2-fluorophenyl)-5-methoxyimino-4-methyl-7,8-dihydro-6H-quinazolin-2-amine |
|---|---|
| PubChem CID | 25167747 |
| Molecular Formula | C16H17FN4O |
| Molecular Weight | 300.34 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | (5E)-7-(2-fluorophenyl)-5-methoxyimino-4-methyl-7,8-dihydro-6H-quinazolin-2-amine |
| SMILES | CO/N=C1\CC(c2ccccc2F)Cc2nc(N)nc(C)c21 |
| InChI | InChI=1S/C16H17FN4O/c1-9-15-13(20-16(18)19-9)7-10(8-14(15)21-22-2)11-5-3-4-6-12(11)17/h3-6,10H,7-8H2,1-2H3,(H2,18,19,20)/b21-14+ |
| InChIKey | BNCXKNWCODZGON-KGENOOAVSA-N |
| XLogP | 2.59 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.34 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|