C17H23N5O2 — CID 58269403
(5E)-5-[2-(dimethylamino)ethoxyimino]-7-(furan-2-yl)-4-methyl-7,8-dihydro-6H-quinazolin-2-amine (PubChem CID 58269403) has the molecular formula C17H23N5O2 and a molecular weight of 329.40 g/mol. Its IUPAC name is (5E)-5-[2-(dimethylamino)ethoxyimino]-7-(furan-2-yl)-4-methyl-7,8-dihydro-6H-quinazolin-2-amine.
| Compound Name | (5E)-5-[2-(dimethylamino)ethoxyimino]-7-(furan-2-yl)-4-methyl-7,8-dihydro-6H-quinazolin-2-amine |
|---|---|
| PubChem CID | 58269403 |
| Molecular Formula | C17H23N5O2 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.19 |
| IUPAC Name | (5E)-5-[2-(dimethylamino)ethoxyimino]-7-(furan-2-yl)-4-methyl-7,8-dihydro-6H-quinazolin-2-amine |
| SMILES | Cc1nc(N)nc2c1/C(=N/OCCN(C)C)CC(c1ccco1)C2 |
| InChI | InChI=1S/C17H23N5O2/c1-11-16-13(20-17(18)19-11)9-12(15-5-4-7-23-15)10-14(16)21-24-8-6-22(2)3/h4-5,7,12H,6,8-10H2,1-3H3,(H2,18,19,20)/b21-14+ |
| InChIKey | MBPUDIZXZHSWKF-KGENOOAVSA-N |
| XLogP | 1.97 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|