C23H32N4O4S3 — CID 89089435
(5R,8S)-5-methyl-8-propan-2-yl-11-[(E)-6-sulfanylhex-1-enyl]-10-oxa-3,17-dithia-7,14,19,20-tetrazatricyclo[14.2.1.12,5]icosa-1(18),2(20),16(19)-triene-6,9,13-trione (PubChem CID 89089435) has the molecular formula C23H32N4O4S3 and a molecular weight of 524.73 g/mol. Its IUPAC name is (5R,8S)-5-methyl-8-propan-2-yl-11-[(E)-6-sulfanylhex-1-enyl]-10-oxa-3,17-dithia-7,14,19,20-tetrazatricyclo[14.2.1.12,5]icosa-1(18),2(20),16(19)-triene-6,9,13-trione.
| Compound Name | (5R,8S)-5-methyl-8-propan-2-yl-11-[(E)-6-sulfanylhex-1-enyl]-10-oxa-3,17-dithia-7,14,19,20-tetrazatricyclo[14.2.1.12,5]icosa-1(18),2(20),16(19)-triene-6,9,13-trione |
|---|---|
| PubChem CID | 89089435 |
| Molecular Formula | C23H32N4O4S3 |
| Molecular Weight | 524.73 g/mol |
| Exact Mass | 524.16 |
| IUPAC Name | (5R,8S)-5-methyl-8-propan-2-yl-11-[(E)-6-sulfanylhex-1-enyl]-10-oxa-3,17-dithia-7,14,19,20-tetrazatricyclo[14.2.1.12,5]icosa-1(18),2(20),16(19)-triene-6,9,13-trione |
| SMILES | CC(C)[C@@H]1NC(=O)[C@]2(C)CSC(=N2)c2csc(n2)CNC(=O)CC(/C=C/CCCCS)OC1=O |
| InChI | InChI=1S/C23H32N4O4S3/c1-14(2)19-21(29)31-15(8-6-4-5-7-9-32)10-17(28)24-11-18-25-16(12-33-18)20-27-23(3,13-34-20)22(30)26-19/h6,8,12,14-15,19,32H,4-5,7,9-11,13H2,1-3H3,(H,24,28)(H,26,30)/b8-6+/t15?,19-,23-/m0/s1 |
| InChIKey | RUVYKMVAINVOHT-OIHGBDKBSA-N |
| XLogP | 3.12 |
| TPSA | 109.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.73 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|