C31H34O9 — CID 89089553
[(2R,4S,6S,7R,10R,13S,14R,15S,16S,18S)-13-acetyloxy-4-ethenyl-16,18-dihydroxy-7,19-dimethyl-20-methylidene-3,5,11-trioxapentacyclo[14.3.1.02,6.07,14.010,13]icosa-1(19),8-dien-15-yl] benzoate (PubChem CID 89089553) has the molecular formula C31H34O9 and a molecular weight of 550.60 g/mol. Its IUPAC name is [(2R,4S,6S,7R,10R,13S,14R,15S,16S,18S)-13-acetyloxy-4-ethenyl-16,18-dihydroxy-7,19-dimethyl-20-methylidene-3,5,11-trioxapentacyclo[14.3.1.02,6.07,14.010,13]icosa-1(19),8-dien-15-yl] benzoate.
| Compound Name | [(2R,4S,6S,7R,10R,13S,14R,15S,16S,18S)-13-acetyloxy-4-ethenyl-16,18-dihydroxy-7,19-dimethyl-20-methylidene-3,5,11-trioxapentacyclo[14.3.1.02,6.07,14.010,13]icosa-1(19),8-dien-15-yl] benzoate |
|---|---|
| PubChem CID | 89089553 |
| Molecular Formula | C31H34O9 |
| Molecular Weight | 550.60 g/mol |
| Exact Mass | 550.22 |
| IUPAC Name | [(2R,4S,6S,7R,10R,13S,14R,15S,16S,18S)-13-acetyloxy-4-ethenyl-16,18-dihydroxy-7,19-dimethyl-20-methylidene-3,5,11-trioxapentacyclo[14.3.1.02,6.07,14.010,13]icosa-1(19),8-dien-15-yl] benzoate |
| SMILES | C=C[C@@H]1O[C@@H]2C3=C(C)[C@@H](O)C[C@](O)(C3=C)[C@@H](OC(=O)c3ccccc3)[C@H]3[C@@](C)(C=C[C@H]4OC[C@]43OC(C)=O)[C@@H]2O1 |
| InChI | InChI=1S/C31H34O9/c1-6-22-37-24-23-16(2)20(33)14-30(35,17(23)3)27(39-28(34)19-10-8-7-9-11-19)25-29(5,26(24)38-22)13-12-21-31(25,15-36-21)40-18(4)32/h6-13,20-22,24-27,33,35H,1,3,14-15H2,2,4-5H3/t20-,21+,22+,24+,25-,26+,27-,29+,30-,31-/m0/s1 |
| InChIKey | FMQGDJLPTALIIP-OPNWLMMDSA-N |
| XLogP | 2.78 |
| TPSA | 120.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.60 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|