About 1-methoxy-2,4-dimethyl-5-methylsulfanylpentane
1-methoxy-2,4-dimethyl-5-methylsulfanylpentane (PubChem CID 89091081) has the molecular formula C9H20OS
and a molecular weight of 176.32 g/mol. Its IUPAC name is 1-methoxy-2,4-dimethyl-5-methylsulfanylpentane.
Analyze 1-methoxy-2,4-dimethyl-5-methylsulfanylpentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxy-2,4-dimethyl-5-methylsulfanylpentane?
The IUPAC name of 1-methoxy-2,4-dimethyl-5-methylsulfanylpentane (CID 89091081) is 1-methoxy-2,4-dimethyl-5-methylsulfanylpentane.
What is the SMILES notation for 1-methoxy-2,4-dimethyl-5-methylsulfanylpentane?
The canonical SMILES for 1-methoxy-2,4-dimethyl-5-methylsulfanylpentane is COCC(C)CC(C)CSC.
What is the InChIKey of 1-methoxy-2,4-dimethyl-5-methylsulfanylpentane?
The InChIKey is MAEPNDDIABCTNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20OS/c1-8(6-10-3)5-9(2)7-11-4/h8-9H,5-7H2,1-4H3.
What are the key properties of 1-methoxy-2,4-dimethyl-5-methylsulfanylpentane?
1-methoxy-2,4-dimethyl-5-methylsulfanylpentane has a molecular weight of 176.32 g/mol, XLogP of 2.66, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxy-2,4-dimethyl-5-methylsulfanylpentane is sourced from PubChem (CID 89091081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).