About 2-fluoroethyl 5-ethyl-8-methyldecanoate
2-fluoroethyl 5-ethyl-8-methyldecanoate (PubChem CID 89091736) has the molecular formula C15H29FO2
and a molecular weight of 260.39 g/mol. Its IUPAC name is 2-fluoroethyl 5-ethyl-8-methyldecanoate.
Molecular Properties
| Compound Name | 2-fluoroethyl 5-ethyl-8-methyldecanoate |
| PubChem CID | 89091736 |
| Molecular Formula | C15H29FO2 |
| Molecular Weight | 260.39 g/mol |
| Exact Mass | 260.22 |
| IUPAC Name | 2-fluoroethyl 5-ethyl-8-methyldecanoate |
| SMILES | CCC(C)CCC(CC)CCCC(=O)OCCF |
| InChI | InChI=1S/C15H29FO2/c1-4-13(3)9-10-14(5-2)7-6-8-15(17)18-12-11-16/h13-14H,4-12H2,1-3H3 |
| InChIKey | SGVIIRLEJZHUOI-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.39 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-fluoroethyl 5-ethyl-8-methyldecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoroethyl 5-ethyl-8-methyldecanoate?
The IUPAC name of 2-fluoroethyl 5-ethyl-8-methyldecanoate (CID 89091736) is 2-fluoroethyl 5-ethyl-8-methyldecanoate.
What is the SMILES notation for 2-fluoroethyl 5-ethyl-8-methyldecanoate?
The canonical SMILES for 2-fluoroethyl 5-ethyl-8-methyldecanoate is CCC(C)CCC(CC)CCCC(=O)OCCF.
What is the InChIKey of 2-fluoroethyl 5-ethyl-8-methyldecanoate?
The InChIKey is SGVIIRLEJZHUOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H29FO2/c1-4-13(3)9-10-14(5-2)7-6-8-15(17)18-12-11-16/h13-14H,4-12H2,1-3H3.
What are the key properties of 2-fluoroethyl 5-ethyl-8-methyldecanoate?
2-fluoroethyl 5-ethyl-8-methyldecanoate has a molecular weight of 260.39 g/mol, XLogP of 4.52, 11 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoroethyl 5-ethyl-8-methyldecanoate is sourced from PubChem (CID 89091736), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).