C17H25N3O4 — CID 89092009
(2S)-3-amino-N-hydroxy-2-[1-[4-[(E)-4-hydroxybut-2-enoxy]phenyl]ethenylamino]-3-methylbutanamide (PubChem CID 89092009) has the molecular formula C17H25N3O4 and a molecular weight of 335.40 g/mol. Its IUPAC name is (2S)-3-amino-N-hydroxy-2-[1-[4-[(E)-4-hydroxybut-2-enoxy]phenyl]ethenylamino]-3-methylbutanamide.
| Compound Name | (2S)-3-amino-N-hydroxy-2-[1-[4-[(E)-4-hydroxybut-2-enoxy]phenyl]ethenylamino]-3-methylbutanamide |
|---|---|
| PubChem CID | 89092009 |
| Molecular Formula | C17H25N3O4 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.18 |
| IUPAC Name | (2S)-3-amino-N-hydroxy-2-[1-[4-[(E)-4-hydroxybut-2-enoxy]phenyl]ethenylamino]-3-methylbutanamide |
| SMILES | C=C(N[C@H](C(=O)NO)C(C)(C)N)c1ccc(OC/C=C/CO)cc1 |
| InChI | InChI=1S/C17H25N3O4/c1-12(19-15(16(22)20-23)17(2,3)18)13-6-8-14(9-7-13)24-11-5-4-10-21/h4-9,15,19,21,23H,1,10-11,18H2,2-3H3,(H,20,22)/b5-4+/t15-/m1/s1 |
| InChIKey | KQGAWYYASGNQQB-MBVDDHJVSA-N |
| XLogP | 0.79 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|