C22H22ClF2NO5 — CID 89094316
1-[[3-(3-chloro-2,6-difluoro-4-methoxyphenyl)-4-methoxybenzoyl]amino]cyclohexane-1-carboxylic acid (PubChem CID 89094316) has the molecular formula C22H22ClF2NO5 and a molecular weight of 453.87 g/mol. Its IUPAC name is 1-[[3-(3-chloro-2,6-difluoro-4-methoxyphenyl)-4-methoxybenzoyl]amino]cyclohexane-1-carboxylic acid.
| Compound Name | 1-[[3-(3-chloro-2,6-difluoro-4-methoxyphenyl)-4-methoxybenzoyl]amino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 89094316 |
| Molecular Formula | C22H22ClF2NO5 |
| Molecular Weight | 453.87 g/mol |
| Exact Mass | 453.12 |
| IUPAC Name | 1-[[3-(3-chloro-2,6-difluoro-4-methoxyphenyl)-4-methoxybenzoyl]amino]cyclohexane-1-carboxylic acid |
| SMILES | COc1ccc(C(=O)NC2(C(=O)O)CCCCC2)cc1-c1c(F)cc(OC)c(Cl)c1F |
| InChI | InChI=1S/C22H22ClF2NO5/c1-30-15-7-6-12(20(27)26-22(21(28)29)8-4-3-5-9-22)10-13(15)17-14(24)11-16(31-2)18(23)19(17)25/h6-7,10-11H,3-5,8-9H2,1-2H3,(H,26,27)(H,28,29) |
| InChIKey | CSOOPERCWDVURJ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.87 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|