C24H23F4N5O3S — CID 89094920
N-[3-[(3R,6S)-5-amino-6-(1,2-dihydropyridin-6-yl)-3,6-dimethyl-1,1-dioxo-2H-1,4-thiazin-3-yl]-4-fluorophenyl]-5-(trifluoromethyl)pyridine-2-carboxamide (PubChem CID 89094920) has the molecular formula C24H23F4N5O3S and a molecular weight of 537.54 g/mol. Its IUPAC name is N-[3-[(3R,6S)-5-amino-6-(1,2-dihydropyridin-6-yl)-3,6-dimethyl-1,1-dioxo-2H-1,4-thiazin-3-yl]-4-fluorophenyl]-5-(trifluoromethyl)pyridine-2-carboxamide.
| Compound Name | N-[3-[(3R,6S)-5-amino-6-(1,2-dihydropyridin-6-yl)-3,6-dimethyl-1,1-dioxo-2H-1,4-thiazin-3-yl]-4-fluorophenyl]-5-(trifluoromethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 89094920 |
| Molecular Formula | C24H23F4N5O3S |
| Molecular Weight | 537.54 g/mol |
| Exact Mass | 537.15 |
| IUPAC Name | N-[3-[(3R,6S)-5-amino-6-(1,2-dihydropyridin-6-yl)-3,6-dimethyl-1,1-dioxo-2H-1,4-thiazin-3-yl]-4-fluorophenyl]-5-(trifluoromethyl)pyridine-2-carboxamide |
| SMILES | C[C@]1(C2=CC=CCN2)C(N)=N[C@](C)(c2cc(NC(=O)c3ccc(C(F)(F)F)cn3)ccc2F)CS1(=O)=O |
| InChI | InChI=1S/C24H23F4N5O3S/c1-22(13-37(35,36)23(2,21(29)33-22)19-5-3-4-10-30-19)16-11-15(7-8-17(16)25)32-20(34)18-9-6-14(12-31-18)24(26,27)28/h3-9,11-12,30H,10,13H2,1-2H3,(H2,29,33)(H,32,34)/t22-,23-/m0/s1 |
| InChIKey | PQMHBCLFLSOQKM-GOTSBHOMSA-N |
| XLogP | 3.29 |
| TPSA | 126.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.54 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |