C22H38O3 — CID 89098619
(9,10,10-trimethyl-7-methylidene-8-oxo-9-propan-2-ylundecyl) 2-methylprop-2-enoate (PubChem CID 89098619) has the molecular formula C22H38O3 and a molecular weight of 350.54 g/mol. Its IUPAC name is (9,10,10-trimethyl-7-methylidene-8-oxo-9-propan-2-ylundecyl) 2-methylprop-2-enoate.
| Compound Name | (9,10,10-trimethyl-7-methylidene-8-oxo-9-propan-2-ylundecyl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 89098619 |
| Molecular Formula | C22H38O3 |
| Molecular Weight | 350.54 g/mol |
| Exact Mass | 350.28 |
| IUPAC Name | (9,10,10-trimethyl-7-methylidene-8-oxo-9-propan-2-ylundecyl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCCCCC(=C)C(=O)C(C)(C(C)C)C(C)(C)C |
| InChI | InChI=1S/C22H38O3/c1-16(2)20(24)25-15-13-11-10-12-14-18(5)19(23)22(9,17(3)4)21(6,7)8/h17H,1,5,10-15H2,2-4,6-9H3 |
| InChIKey | LKNRJWITWCGUND-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.54 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|