C33H41FN4O3 — CID 89099554
(E,3R,5S)-7-[13-[2-(dimethylamino)ethylamino]-6-(4-fluorophenyl)-4-propan-2-yl-3,12-diazatricyclo[9.4.0.02,7]pentadeca-1(11),2,4,6,12,14-hexaen-5-yl]-3,5-dihydroxyhept-6-enal (PubChem CID 89099554) has the molecular formula C33H41FN4O3 and a molecular weight of 560.71 g/mol. Its IUPAC name is (E,3R,5S)-7-[13-[2-(dimethylamino)ethylamino]-6-(4-fluorophenyl)-4-propan-2-yl-3,12-diazatricyclo[9.4.0.02,7]pentadeca-1(11),2,4,6,12,14-hexaen-5-yl]-3,5-dihydroxyhept-6-enal.
| Compound Name | (E,3R,5S)-7-[13-[2-(dimethylamino)ethylamino]-6-(4-fluorophenyl)-4-propan-2-yl-3,12-diazatricyclo[9.4.0.02,7]pentadeca-1(11),2,4,6,12,14-hexaen-5-yl]-3,5-dihydroxyhept-6-enal |
|---|---|
| PubChem CID | 89099554 |
| Molecular Formula | C33H41FN4O3 |
| Molecular Weight | 560.71 g/mol |
| Exact Mass | 560.32 |
| IUPAC Name | (E,3R,5S)-7-[13-[2-(dimethylamino)ethylamino]-6-(4-fluorophenyl)-4-propan-2-yl-3,12-diazatricyclo[9.4.0.02,7]pentadeca-1(11),2,4,6,12,14-hexaen-5-yl]-3,5-dihydroxyhept-6-enal |
| SMILES | CC(C)c1nc2c(c(-c3ccc(F)cc3)c1/C=C/[C@@H](O)C[C@@H](O)CC=O)CCCc1nc(NCCN(C)C)ccc1-2 |
| InChI | InChI=1S/C33H41FN4O3/c1-21(2)32-28(13-12-24(40)20-25(41)16-19-39)31(22-8-10-23(34)11-9-22)27-6-5-7-29-26(33(27)37-32)14-15-30(36-29)35-17-18-38(3)4/h8-15,19,21,24-25,40-41H,5-7,16-18,20H2,1-4H3,(H,35,36)/b13-12+/t24-,25+/m1/s1 |
| InChIKey | QOMWSNKUQCSCNZ-QMQMXIOFSA-N |
| XLogP | 5.25 |
| TPSA | 98.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.71 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|