C20H18ClFN4O3 — CID 89099745
1-(4-benzoylpiperazin-1-yl)-2-(7-chloro-4-fluoro-2,3-dihydro-1H-pyrrolo[2,3-c]pyridin-3-yl)ethane-1,2-dione (PubChem CID 89099745) has the molecular formula C20H18ClFN4O3 and a molecular weight of 416.84 g/mol. Its IUPAC name is 1-(4-benzoylpiperazin-1-yl)-2-(7-chloro-4-fluoro-2,3-dihydro-1H-pyrrolo[2,3-c]pyridin-3-yl)ethane-1,2-dione.
| Compound Name | 1-(4-benzoylpiperazin-1-yl)-2-(7-chloro-4-fluoro-2,3-dihydro-1H-pyrrolo[2,3-c]pyridin-3-yl)ethane-1,2-dione |
|---|---|
| PubChem CID | 89099745 |
| Molecular Formula | C20H18ClFN4O3 |
| Molecular Weight | 416.84 g/mol |
| Exact Mass | 416.11 |
| IUPAC Name | 1-(4-benzoylpiperazin-1-yl)-2-(7-chloro-4-fluoro-2,3-dihydro-1H-pyrrolo[2,3-c]pyridin-3-yl)ethane-1,2-dione |
| SMILES | O=C(C(=O)N1CCN(C(=O)c2ccccc2)CC1)C1CNc2c(Cl)ncc(F)c21 |
| InChI | InChI=1S/C20H18ClFN4O3/c21-18-16-15(14(22)11-24-18)13(10-23-16)17(27)20(29)26-8-6-25(7-9-26)19(28)12-4-2-1-3-5-12/h1-5,11,13,23H,6-10H2 |
| InChIKey | MWBKXMOWAHZIBN-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.84 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|