C21H20ClFN4O2 — CID 142861442
2-(7-chloro-4-fluoro-1H-pyrrolo[2,3-c]pyridin-3-yl)prop-2-enal;phenyl(piperazin-1-yl)methanone (PubChem CID 142861442) has the molecular formula C21H20ClFN4O2 and a molecular weight of 414.87 g/mol. Its IUPAC name is 2-(7-chloro-4-fluoro-1H-pyrrolo[2,3-c]pyridin-3-yl)prop-2-enal;phenyl(piperazin-1-yl)methanone.
| Compound Name | 2-(7-chloro-4-fluoro-1H-pyrrolo[2,3-c]pyridin-3-yl)prop-2-enal;phenyl(piperazin-1-yl)methanone |
|---|---|
| PubChem CID | 142861442 |
| Molecular Formula | C21H20ClFN4O2 |
| Molecular Weight | 414.87 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | 2-(7-chloro-4-fluoro-1H-pyrrolo[2,3-c]pyridin-3-yl)prop-2-enal;phenyl(piperazin-1-yl)methanone |
| SMILES | C=C(C=O)c1c[nH]c2c(Cl)ncc(F)c12.O=C(c1ccccc1)N1CCNCC1 |
| InChI | InChI=1S/C11H14N2O.C10H6ClFN2O/c14-11(10-4-2-1-3-5-10)13-8-6-12-7-9-13;1-5(4-15)6-2-13-9-8(6)7(12)3-14-10(9)11/h1-5,12H,6-9H2;2-4,13H,1H2 |
| InChIKey | AYUWYUFBNXEDOE-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.87 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|