C15H30N2O4 — CID 89103498
2-[3-[(1-carboxy-2-methylpropyl)amino]propylamino]-2,3,3-trimethylbutanoic acid (PubChem CID 89103498) has the molecular formula C15H30N2O4 and a molecular weight of 302.42 g/mol. Its IUPAC name is 2-[3-[(1-carboxy-2-methylpropyl)amino]propylamino]-2,3,3-trimethylbutanoic acid.
| Compound Name | 2-[3-[(1-carboxy-2-methylpropyl)amino]propylamino]-2,3,3-trimethylbutanoic acid |
|---|---|
| PubChem CID | 89103498 |
| Molecular Formula | C15H30N2O4 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | 2-[3-[(1-carboxy-2-methylpropyl)amino]propylamino]-2,3,3-trimethylbutanoic acid |
| SMILES | CC(C)C(NCCCNC(C)(C(=O)O)C(C)(C)C)C(=O)O |
| InChI | InChI=1S/C15H30N2O4/c1-10(2)11(12(18)19)16-8-7-9-17-15(6,13(20)21)14(3,4)5/h10-11,16-17H,7-9H2,1-6H3,(H,18,19)(H,20,21) |
| InChIKey | RUIBEQAJQNZUAF-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|