C20H10ClF9N2O2 — CID 89106089
N-[2-chloro-6-(difluoromethoxy)-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]quinoline-6-carboxamide (PubChem CID 89106089) has the molecular formula C20H10ClF9N2O2 and a molecular weight of 516.75 g/mol. Its IUPAC name is N-[2-chloro-6-(difluoromethoxy)-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]quinoline-6-carboxamide.
| Compound Name | N-[2-chloro-6-(difluoromethoxy)-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]quinoline-6-carboxamide |
|---|---|
| PubChem CID | 89106089 |
| Molecular Formula | C20H10ClF9N2O2 |
| Molecular Weight | 516.75 g/mol |
| Exact Mass | 516.03 |
| IUPAC Name | N-[2-chloro-6-(difluoromethoxy)-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]quinoline-6-carboxamide |
| SMILES | O=C(Nc1c(OC(F)F)ccc(C(F)(C(F)(F)F)C(F)(F)F)c1Cl)c1ccc2ncccc2c1 |
| InChI | InChI=1S/C20H10ClF9N2O2/c21-14-11(18(24,19(25,26)27)20(28,29)30)4-6-13(34-17(22)23)15(14)32-16(33)10-3-5-12-9(8-10)2-1-7-31-12/h1-8,17H,(H,32,33) |
| InChIKey | YCLIIXAPDCXUJR-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.75 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |