C5H13IN2 — CID 89108168
(1R)-1-iodo-N-propylethane-1,2-diamine (PubChem CID 89108168) has the molecular formula C5H13IN2 and a molecular weight of 228.08 g/mol. Its IUPAC name is (1R)-1-iodo-N-propylethane-1,2-diamine.
| Compound Name | (1R)-1-iodo-N-propylethane-1,2-diamine |
|---|---|
| PubChem CID | 89108168 |
| Molecular Formula | C5H13IN2 |
| Molecular Weight | 228.08 g/mol |
| Exact Mass | 228.01 |
| IUPAC Name | (1R)-1-iodo-N-propylethane-1,2-diamine |
| SMILES | CCCNC(I)CN |
| InChI | InChI=1S/C5H13IN2/c1-2-3-8-5(6)4-7/h5,8H,2-4,7H2,1H3 |
| InChIKey | ARUSFNGEGAPRJD-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.08 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|