C30H41FN6O4 — CID 89114085
4-[[(3R,9R,12R)-6-ethyl-21-fluoro-3,8,9-trimethyl-7,10,13-trioxo-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(18),19,21-trien-12-yl]methyl]benzenecarboximidamide (PubChem CID 89114085) has the molecular formula C30H41FN6O4 and a molecular weight of 568.69 g/mol. Its IUPAC name is 4-[[(3R,9R,12R)-6-ethyl-21-fluoro-3,8,9-trimethyl-7,10,13-trioxo-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(18),19,21-trien-12-yl]methyl]benzenecarboximidamide.
| Compound Name | 4-[[(3R,9R,12R)-6-ethyl-21-fluoro-3,8,9-trimethyl-7,10,13-trioxo-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(18),19,21-trien-12-yl]methyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 89114085 |
| Molecular Formula | C30H41FN6O4 |
| Molecular Weight | 568.69 g/mol |
| Exact Mass | 568.32 |
| IUPAC Name | 4-[[(3R,9R,12R)-6-ethyl-21-fluoro-3,8,9-trimethyl-7,10,13-trioxo-2-oxa-5,8,11,14-tetrazabicyclo[16.4.0]docosa-1(18),19,21-trien-12-yl]methyl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(C[C@H]2NC(=O)[C@@H](C)N(C)C(=O)C(CC)NC[C@@H](C)Oc3cc(F)ccc3CCCNC2=O)cc1 |
| InChI | InChI=1S/C30H41FN6O4/c1-5-24-30(40)37(4)19(3)28(38)36-25(15-20-8-10-22(11-9-20)27(32)33)29(39)34-14-6-7-21-12-13-23(31)16-26(21)41-18(2)17-35-24/h8-13,16,18-19,24-25,35H,5-7,14-15,17H2,1-4H3,(H3,32,33)(H,34,39)(H,36,38)/t18-,19-,24?,25-/m1/s1 |
| InChIKey | LNRVRHHIFUTKEB-FGKBVBPSSA-N |
| XLogP | 1.88 |
| TPSA | 149.64 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.69 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|