C19H15NO5 — CID 89114835
2-[(6,7-dimethyl-2-oxochromene-3-carbonyl)amino]benzoic acid (PubChem CID 89114835) has the molecular formula C19H15NO5 and a molecular weight of 337.33 g/mol. Its IUPAC name is 2-[(6,7-dimethyl-2-oxochromene-3-carbonyl)amino]benzoic acid.
| Compound Name | 2-[(6,7-dimethyl-2-oxochromene-3-carbonyl)amino]benzoic acid |
|---|---|
| PubChem CID | 89114835 |
| Molecular Formula | C19H15NO5 |
| Molecular Weight | 337.33 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | 2-[(6,7-dimethyl-2-oxochromene-3-carbonyl)amino]benzoic acid |
| SMILES | Cc1cc2cc(C(=O)Nc3ccccc3C(=O)O)c(=O)oc2cc1C |
| InChI | InChI=1S/C19H15NO5/c1-10-7-12-9-14(19(24)25-16(12)8-11(10)2)17(21)20-15-6-4-3-5-13(15)18(22)23/h3-9H,1-2H3,(H,20,21)(H,22,23) |
| InChIKey | PBAPWSNDZDXARP-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.33 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|